C19H21NO — CID 10779068
(3aS,6R,6aR)-1-benzyl-6-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole (PubChem CID 10779068) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is (3aS,6R,6aR)-1-benzyl-6-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole.
| Compound Name | (3aS,6R,6aR)-1-benzyl-6-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole |
|---|---|
| PubChem CID | 10779068 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | (3aS,6R,6aR)-1-benzyl-6-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazole |
| SMILES | c1ccc(CN2OC[C@H]3CC[C@H](c4ccccc4)[C@H]32)cc1 |
| InChI | InChI=1S/C19H21NO/c1-3-7-15(8-4-1)13-20-19-17(14-21-20)11-12-18(19)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2/t17-,18-,19+/m1/s1 |
| InChIKey | MZZSDBIDMUHMAY-QRVBRYPASA-N |
| XLogP | 4.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |