C29H35NO2Si — CID 10671554
[(3aS,6S,6aS)-1-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-6-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 10671554) has the molecular formula C29H35NO2Si and a molecular weight of 457.69 g/mol. Its IUPAC name is [(3aS,6S,6aS)-1-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-6-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,6S,6aS)-1-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-6-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10671554 |
| Molecular Formula | C29H35NO2Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | [(3aS,6S,6aS)-1-benzyl-3,3a,4,5,6,6a-hexahydrocyclopenta[c][1,2]oxazol-6-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@H]1CC[C@@H]2CON(Cc3ccccc3)[C@@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO2Si/c1-29(2,3)33(25-15-9-5-10-16-25,26-17-11-6-12-18-26)32-27-20-19-24-22-31-30(28(24)27)21-23-13-7-4-8-14-23/h4-18,24,27-28H,19-22H2,1-3H3/t24-,27+,28+/m1/s1 |
| InChIKey | GORSTEVFNPSWFH-KGPYPHOUSA-N |
| XLogP | 5.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|