C24H23NO2 — CID 15429864
(3R,3aS,6S,6aR)-1-benzyl-3,6-diphenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole (PubChem CID 15429864) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3R,3aS,6S,6aR)-1-benzyl-3,6-diphenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole.
| Compound Name | (3R,3aS,6S,6aR)-1-benzyl-3,6-diphenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 15429864 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (3R,3aS,6S,6aR)-1-benzyl-3,6-diphenyl-3a,4,6,6a-tetrahydro-3H-furo[3,4-c][1,2]oxazole |
| SMILES | c1ccc(CN2O[C@@H](c3ccccc3)[C@@H]3CO[C@@H](c4ccccc4)[C@@H]32)cc1 |
| InChI | InChI=1S/C24H23NO2/c1-4-10-18(11-5-1)16-25-22-21(23(27-25)19-12-6-2-7-13-19)17-26-24(22)20-14-8-3-9-15-20/h1-15,21-24H,16-17H2/t21-,22-,23+,24+/m1/s1 |
| InChIKey | MOCRPBPHXWAUMB-LWSSLDFYSA-N |
| XLogP | 4.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |