C18H19NO2 — CID 23649728
(3S,3aS,6aR)-2-benzyl-3-phenyl-3a,4,5,6a-tetrahydro-3H-furo[3,2-d][1,2]oxazole (PubChem CID 23649728) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-benzyl-3-phenyl-3a,4,5,6a-tetrahydro-3H-furo[3,2-d][1,2]oxazole.
| Compound Name | (3S,3aS,6aR)-2-benzyl-3-phenyl-3a,4,5,6a-tetrahydro-3H-furo[3,2-d][1,2]oxazole |
|---|---|
| PubChem CID | 23649728 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3S,3aS,6aR)-2-benzyl-3-phenyl-3a,4,5,6a-tetrahydro-3H-furo[3,2-d][1,2]oxazole |
| SMILES | c1ccc(CN2O[C@H]3OCC[C@H]3[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO2/c1-3-7-14(8-4-1)13-19-17(15-9-5-2-6-10-15)16-11-12-20-18(16)21-19/h1-10,16-18H,11-13H2/t16-,17+,18+/m0/s1 |
| InChIKey | GAOQNFGWJSEZDL-RCCFBDPRSA-N |
| XLogP | 3.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |