C16H16BrNO2 — CID 135023637
(3R,4S)-2-benzyl-4-bromo-3-phenyl-1,2-oxazolidin-5-ol (PubChem CID 135023637) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is (3R,4S)-2-benzyl-4-bromo-3-phenyl-1,2-oxazolidin-5-ol.
| Compound Name | (3R,4S)-2-benzyl-4-bromo-3-phenyl-1,2-oxazolidin-5-ol |
|---|---|
| PubChem CID | 135023637 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (3R,4S)-2-benzyl-4-bromo-3-phenyl-1,2-oxazolidin-5-ol |
| SMILES | OC1ON(Cc2ccccc2)[C@H](c2ccccc2)[C@@H]1Br |
| InChI | InChI=1S/C16H16BrNO2/c17-14-15(13-9-5-2-6-10-13)18(20-16(14)19)11-12-7-3-1-4-8-12/h1-10,14-16,19H,11H2/t14-,15+,16?/m0/s1 |
| InChIKey | PAKKDORHMCHGQC-QMRHZFGWSA-N |
| XLogP | 3.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|