C28H29NO4 — CID 46188162
(1S,2S,6S,7R,8S,9S)-3-benzyl-8,9-bis(phenylmethoxy)-4,10-dioxa-3-azatricyclo[5.2.1.02,6]decane (PubChem CID 46188162) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is (1S,2S,6S,7R,8S,9S)-3-benzyl-8,9-bis(phenylmethoxy)-4,10-dioxa-3-azatricyclo[5.2.1.02,6]decane.
| Compound Name | (1S,2S,6S,7R,8S,9S)-3-benzyl-8,9-bis(phenylmethoxy)-4,10-dioxa-3-azatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 46188162 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (1S,2S,6S,7R,8S,9S)-3-benzyl-8,9-bis(phenylmethoxy)-4,10-dioxa-3-azatricyclo[5.2.1.02,6]decane |
| SMILES | c1ccc(CO[C@@H]2[C@@H](OCc3ccccc3)[C@H]3O[C@@H]2[C@@H]2CON(Cc4ccccc4)[C@@H]23)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-4-10-20(11-5-1)16-29-24-23(19-32-29)25-27(30-17-21-12-6-2-7-13-21)28(26(24)33-25)31-18-22-14-8-3-9-15-22/h1-15,23-28H,16-19H2/t23-,24+,25-,26+,27+,28+/m1/s1 |
| InChIKey | ZCIYJXBFMUMMNG-UTTSYVKVSA-N |
| XLogP | 4.37 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |