C21H25NO5 — CID 134833173
(4S,5R,6S)-1-benzyl-4-(hydroxymethyl)-5-phenylmethoxy-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole-4,6-diol (PubChem CID 134833173) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is (4S,5R,6S)-1-benzyl-4-(hydroxymethyl)-5-phenylmethoxy-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole-4,6-diol.
| Compound Name | (4S,5R,6S)-1-benzyl-4-(hydroxymethyl)-5-phenylmethoxy-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole-4,6-diol |
|---|---|
| PubChem CID | 134833173 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (4S,5R,6S)-1-benzyl-4-(hydroxymethyl)-5-phenylmethoxy-3a,5,6,6a-tetrahydro-3H-cyclopenta[c][1,2]oxazole-4,6-diol |
| SMILES | OC[C@@]1(O)C2CON(Cc3ccccc3)C2[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H25NO5/c23-14-21(25)17-13-27-22(11-15-7-3-1-4-8-15)18(17)19(24)20(21)26-12-16-9-5-2-6-10-16/h1-10,17-20,23-25H,11-14H2/t17?,18?,19-,20+,21+/m0/s1 |
| InChIKey | WESPEATVGINKLC-JRGKDQQJSA-N |
| XLogP | 1.10 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |