C27H31N — CID 68572707
2-benzyl-1,1,3,3-tetrakis(prop-2-enyl)isoindole (PubChem CID 68572707) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is 2-benzyl-1,1,3,3-tetrakis(prop-2-enyl)isoindole.
| Compound Name | 2-benzyl-1,1,3,3-tetrakis(prop-2-enyl)isoindole |
|---|---|
| PubChem CID | 68572707 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 2-benzyl-1,1,3,3-tetrakis(prop-2-enyl)isoindole |
| SMILES | C=CCC1(CC=C)c2ccccc2C(CC=C)(CC=C)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H31N/c1-5-18-26(19-6-2)24-16-12-13-17-25(24)27(20-7-3,21-8-4)28(26)22-23-14-10-9-11-15-23/h5-17H,1-4,18-22H2 |
| InChIKey | RMGSOCANHHQVLB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|