C26H31N3 — CID 155782573
4-(3-benzyl-9-prop-2-enyl-3-azabicyclo[3.3.1]nonan-9-yl)-2-methyl-1H-benzimidazole (PubChem CID 155782573) has the molecular formula C26H31N3 and a molecular weight of 385.56 g/mol. Its IUPAC name is 4-(3-benzyl-9-prop-2-enyl-3-azabicyclo[3.3.1]nonan-9-yl)-2-methyl-1H-benzimidazole.
| Compound Name | 4-(3-benzyl-9-prop-2-enyl-3-azabicyclo[3.3.1]nonan-9-yl)-2-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 155782573 |
| Molecular Formula | C26H31N3 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | 4-(3-benzyl-9-prop-2-enyl-3-azabicyclo[3.3.1]nonan-9-yl)-2-methyl-1H-benzimidazole |
| SMILES | C=CCC1(c2cccc3[nH]c(C)nc23)C2CCCC1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C26H31N3/c1-3-15-26(23-13-8-14-24-25(23)28-19(2)27-24)21-11-7-12-22(26)18-29(17-21)16-20-9-5-4-6-10-20/h3-6,8-10,13-14,21-22H,1,7,11-12,15-18H2,2H3,(H,27,28) |
| InChIKey | KDILKIQYXSLPKE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|