C15H20OS — CID 100944567
(2S,3R,5S)-2,5-dimethyl-3-phenylsulfanyl-2-prop-2-enyloxolane (PubChem CID 100944567) has the molecular formula C15H20OS and a molecular weight of 248.39 g/mol. Its IUPAC name is (2S,3R,5S)-2,5-dimethyl-3-phenylsulfanyl-2-prop-2-enyloxolane.
| Compound Name | (2S,3R,5S)-2,5-dimethyl-3-phenylsulfanyl-2-prop-2-enyloxolane |
|---|---|
| PubChem CID | 100944567 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2S,3R,5S)-2,5-dimethyl-3-phenylsulfanyl-2-prop-2-enyloxolane |
| SMILES | C=CC[C@]1(C)O[C@@H](C)C[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C15H20OS/c1-4-10-15(3)14(11-12(2)16-15)17-13-8-6-5-7-9-13/h4-9,12,14H,1,10-11H2,2-3H3/t12-,14+,15-/m0/s1 |
| InChIKey | AWCLNTQQEFBYFQ-CFVMTHIKSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|