C17H20O2S2 — CID 6426079
4-methyl-3-phenylsulfanyl-5,5-bis(prop-2-enyl)-2H-thiophene 1,1-dioxide (PubChem CID 6426079) has the molecular formula C17H20O2S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 4-methyl-3-phenylsulfanyl-5,5-bis(prop-2-enyl)-2H-thiophene 1,1-dioxide.
| Compound Name | 4-methyl-3-phenylsulfanyl-5,5-bis(prop-2-enyl)-2H-thiophene 1,1-dioxide |
|---|---|
| PubChem CID | 6426079 |
| Molecular Formula | C17H20O2S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-methyl-3-phenylsulfanyl-5,5-bis(prop-2-enyl)-2H-thiophene 1,1-dioxide |
| SMILES | C=CCC1(CC=C)C(C)=C(Sc2ccccc2)CS1(=O)=O |
| InChI | InChI=1S/C17H20O2S2/c1-4-11-17(12-5-2)14(3)16(13-21(17,18)19)20-15-9-7-6-8-10-15/h4-10H,1-2,11-13H2,3H3 |
| InChIKey | FHKZJGSZDUEGEN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|