C20H21NO5S2 — CID 162415417
N-benzyl-N-methylsulfonyl-2,2-dioxo-1-prop-2-enyl-3H-2-benzothiophene-1-carboxamide (PubChem CID 162415417) has the molecular formula C20H21NO5S2 and a molecular weight of 419.52 g/mol. Its IUPAC name is N-benzyl-N-methylsulfonyl-2,2-dioxo-1-prop-2-enyl-3H-2-benzothiophene-1-carboxamide.
| Compound Name | N-benzyl-N-methylsulfonyl-2,2-dioxo-1-prop-2-enyl-3H-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 162415417 |
| Molecular Formula | C20H21NO5S2 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-benzyl-N-methylsulfonyl-2,2-dioxo-1-prop-2-enyl-3H-2-benzothiophene-1-carboxamide |
| SMILES | C=CCC1(C(=O)N(Cc2ccccc2)S(C)(=O)=O)c2ccccc2CS1(=O)=O |
| InChI | InChI=1S/C20H21NO5S2/c1-3-13-20(18-12-8-7-11-17(18)15-28(20,25)26)19(22)21(27(2,23)24)14-16-9-5-4-6-10-16/h3-12H,1,13-15H2,2H3 |
| InChIKey | UGJTUHXLWHRTGQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|