C20H31NO3S — CID 174468529
ethyl N-benzyl-N-(1,2-dimethyl-2-prop-2-enylcyclohexyl)sulfamate (PubChem CID 174468529) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is ethyl N-benzyl-N-(1,2-dimethyl-2-prop-2-enylcyclohexyl)sulfamate.
| Compound Name | ethyl N-benzyl-N-(1,2-dimethyl-2-prop-2-enylcyclohexyl)sulfamate |
|---|---|
| PubChem CID | 174468529 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl N-benzyl-N-(1,2-dimethyl-2-prop-2-enylcyclohexyl)sulfamate |
| SMILES | C=CCC1(C)CCCCC1(C)N(Cc1ccccc1)S(=O)(=O)OCC |
| InChI | InChI=1S/C20H31NO3S/c1-5-14-19(3)15-10-11-16-20(19,4)21(25(22,23)24-6-2)17-18-12-8-7-9-13-18/h5,7-9,12-13H,1,6,10-11,14-17H2,2-4H3 |
| InChIKey | ZCYYKTCBTLCQTH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|