C25H42O3S — CID 158318840
ethane;methanol;methyl 2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)prop-2-enoate (PubChem CID 158318840) has the molecular formula C25H42O3S and a molecular weight of 422.68 g/mol. Its IUPAC name is ethane;methanol;methyl 2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)prop-2-enoate.
| Compound Name | ethane;methanol;methyl 2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 158318840 |
| Molecular Formula | C25H42O3S |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | ethane;methanol;methyl 2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1=C(Sc2ccccc2)CC(C)=C(C)C1.CC.CC.CC.CO |
| InChI | InChI=1S/C18H20O2S.3C2H6.CH4O/c1-12-10-16(14(3)18(19)20-4)17(11-13(12)2)21-15-8-6-5-7-9-15;4*1-2/h5-9H,3,10-11H2,1-2,4H3;3*1-2H3;2H,1H3 |
| InChIKey | GOPCAYLMXZAKMJ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|