C24H39NO3S — CID 172960304
ethane;methyl (2Z)-2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)-2-methoxyiminoacetate (PubChem CID 172960304) has the molecular formula C24H39NO3S and a molecular weight of 421.65 g/mol. Its IUPAC name is ethane;methyl (2Z)-2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)-2-methoxyiminoacetate.
| Compound Name | ethane;methyl (2Z)-2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 172960304 |
| Molecular Formula | C24H39NO3S |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | ethane;methyl (2Z)-2-(4,5-dimethyl-2-phenylsulfanylcyclohexa-1,4-dien-1-yl)-2-methoxyiminoacetate |
| SMILES | CC.CC.CC.CO/N=C(\C(=O)OC)C1=C(Sc2ccccc2)CC(C)=C(C)C1 |
| InChI | InChI=1S/C18H21NO3S.3C2H6/c1-12-10-15(17(19-22-4)18(20)21-3)16(11-13(12)2)23-14-8-6-5-7-9-14;3*1-2/h5-9H,10-11H2,1-4H3;3*1-2H3/b19-17-;;; |
| InChIKey | FHTSWYCDORLAKW-SHFIFAJNSA-N |
| XLogP | 7.42 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|