C20H33NO4 — CID 91009589
methanol;methyl 2-[4,5-dimethyl-2-[2-methyl-1-(propan-2-ylideneamino)oxypropan-2-yl]cyclohexa-1,4-dien-1-yl]prop-2-enoate (PubChem CID 91009589) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is methanol;methyl 2-[4,5-dimethyl-2-[2-methyl-1-(propan-2-ylideneamino)oxypropan-2-yl]cyclohexa-1,4-dien-1-yl]prop-2-enoate.
| Compound Name | methanol;methyl 2-[4,5-dimethyl-2-[2-methyl-1-(propan-2-ylideneamino)oxypropan-2-yl]cyclohexa-1,4-dien-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91009589 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | methanol;methyl 2-[4,5-dimethyl-2-[2-methyl-1-(propan-2-ylideneamino)oxypropan-2-yl]cyclohexa-1,4-dien-1-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1=C(C(C)(C)CON=C(C)C)CC(C)=C(C)C1.CO |
| InChI | InChI=1S/C19H29NO3.CH4O/c1-12(2)20-23-11-19(6,7)17-10-14(4)13(3)9-16(17)15(5)18(21)22-8;1-2/h5,9-11H2,1-4,6-8H3;2H,1H3 |
| InChIKey | JCDFKSIUIXVBGD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|