C12H17NO3W — CID 172981590
(1Z)-1-(2-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-1-methoxyiminopropan-2-one;tungsten (PubChem CID 172981590) has the molecular formula C12H17NO3W and a molecular weight of 407.11 g/mol. Its IUPAC name is (1Z)-1-(2-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-1-methoxyiminopropan-2-one;tungsten.
| Compound Name | (1Z)-1-(2-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-1-methoxyiminopropan-2-one;tungsten |
|---|---|
| PubChem CID | 172981590 |
| Molecular Formula | C12H17NO3W |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | (1Z)-1-(2-hydroxy-4,5-dimethylcyclohexa-1,4-dien-1-yl)-1-methoxyiminopropan-2-one;tungsten |
| SMILES | CO/N=C(\C(C)=O)C1=C(O)CC(C)=C(C)C1.[W] |
| InChI | InChI=1S/C12H17NO3.W/c1-7-5-10(11(15)6-8(7)2)12(9(3)14)13-16-4;/h15H,5-6H2,1-4H3;/b13-12+; |
| InChIKey | PGXSYBIGVYQURI-UEIGIMKUSA-N |
| XLogP | 2.52 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|