C21H26O3 — CID 20699988
methyl (Z)-2-[4,5-dimethyl-2-(2-phenylethyl)cyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoate (PubChem CID 20699988) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is methyl (Z)-2-[4,5-dimethyl-2-(2-phenylethyl)cyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoate.
| Compound Name | methyl (Z)-2-[4,5-dimethyl-2-(2-phenylethyl)cyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 20699988 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | methyl (Z)-2-[4,5-dimethyl-2-(2-phenylethyl)cyclohexa-1,4-dien-1-yl]-3-methoxyprop-2-enoate |
| SMILES | CO/C=C(\C(=O)OC)C1=C(CCc2ccccc2)CC(C)=C(C)C1 |
| InChI | InChI=1S/C21H26O3/c1-15-12-18(11-10-17-8-6-5-7-9-17)19(13-16(15)2)20(14-23-3)21(22)24-4/h5-9,14H,10-13H2,1-4H3/b20-14- |
| InChIKey | QXBAWCTWYFFIFG-ZHZULCJRSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|