C15H22O2S — CID 100947755
(2R,3R,5S)-2,5-dimethyl-2-(3-phenylsulfanylpropyl)oxolan-3-ol (PubChem CID 100947755) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is (2R,3R,5S)-2,5-dimethyl-2-(3-phenylsulfanylpropyl)oxolan-3-ol.
| Compound Name | (2R,3R,5S)-2,5-dimethyl-2-(3-phenylsulfanylpropyl)oxolan-3-ol |
|---|---|
| PubChem CID | 100947755 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2R,3R,5S)-2,5-dimethyl-2-(3-phenylsulfanylpropyl)oxolan-3-ol |
| SMILES | C[C@H]1C[C@@H](O)[C@@](C)(CCCSc2ccccc2)O1 |
| InChI | InChI=1S/C15H22O2S/c1-12-11-14(16)15(2,17-12)9-6-10-18-13-7-4-3-5-8-13/h3-5,7-8,12,14,16H,6,9-11H2,1-2H3/t12-,14+,15+/m0/s1 |
| InChIKey | BVZDNSAAVVZZGQ-NWANDNLSSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|