C23H22NO3P — CID 23420421
2-[(3aS)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]phenol (PubChem CID 23420421) has the molecular formula C23H22NO3P and a molecular weight of 391.41 g/mol. Its IUPAC name is 2-[(3aS)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]phenol.
| Compound Name | 2-[(3aS)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]phenol |
|---|---|
| PubChem CID | 23420421 |
| Molecular Formula | C23H22NO3P |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-[(3aS)-1-oxo-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaphosphol-1-yl]phenol |
| SMILES | O=P1(c2ccccc2O)OC(c2ccccc2)(c2ccccc2)[C@@H]2CCCN21 |
| InChI | InChI=1S/C23H22NO3P/c25-20-14-7-8-15-21(20)28(26)24-17-9-16-22(24)23(27-28,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-8,10-15,22,25H,9,16-17H2/t22-,28?/m0/s1 |
| InChIKey | HEBGOJHUAOWBQH-XYXHBKGXSA-N |
| XLogP | 4.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|