C17H19N2O2P — CID 11088318
2-[(1R,3aS)-1-oxo-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenol (PubChem CID 11088318) has the molecular formula C17H19N2O2P and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-[(1R,3aS)-1-oxo-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenol.
| Compound Name | 2-[(1R,3aS)-1-oxo-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenol |
|---|---|
| PubChem CID | 11088318 |
| Molecular Formula | C17H19N2O2P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[(1R,3aS)-1-oxo-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphol-1-yl]phenol |
| SMILES | O=[P@@]1(c2ccccc2O)N(c2ccccc2)C[C@@H]2CCCN21 |
| InChI | InChI=1S/C17H19N2O2P/c20-16-10-4-5-11-17(16)22(21)18-12-6-9-15(18)13-19(22)14-7-2-1-3-8-14/h1-5,7-8,10-11,15,20H,6,9,12-13H2/t15-,22+/m0/s1 |
| InChIKey | GYOTYUYIKFRMIP-OYHNWAKOSA-N |
| XLogP | 3.20 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|