C25H35N2O2P — CID 10526465
(1R,3aS)-1-(2,4-ditert-butylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide (PubChem CID 10526465) has the molecular formula C25H35N2O2P and a molecular weight of 426.54 g/mol. Its IUPAC name is (1R,3aS)-1-(2,4-ditert-butylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide.
| Compound Name | (1R,3aS)-1-(2,4-ditert-butylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide |
|---|---|
| PubChem CID | 10526465 |
| Molecular Formula | C25H35N2O2P |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (1R,3aS)-1-(2,4-ditert-butylphenoxy)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide |
| SMILES | CC(C)(C)c1ccc(O[P@@]2(=O)N(c3ccccc3)C[C@@H]3CCCN32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H35N2O2P/c1-24(2,3)19-14-15-23(22(17-19)25(4,5)6)29-30(28)26-16-10-13-21(26)18-27(30)20-11-8-7-9-12-20/h7-9,11-12,14-15,17,21H,10,13,16,18H2,1-6H3/t21-,30+/m0/s1 |
| InChIKey | MAOLZHMCRMZWMV-URAOTHONSA-N |
| XLogP | 6.75 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|