C19H30O2 — CID 67808829
trans-(1S,2S)-2-(2,4-ditert-butylphenoxy)cyclopentan-1-ol (PubChem CID 67808829) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2,4-ditert-butylphenoxy)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2,4-ditert-butylphenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 67808829 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | trans-(1S,2S)-2-(2,4-ditert-butylphenoxy)cyclopentan-1-ol |
| SMILES | CC(C)(C)c1ccc(O[C@H]2CCC[C@@H]2O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O2/c1-18(2,3)13-10-11-16(14(12-13)19(4,5)6)21-17-9-7-8-15(17)20/h10-12,15,17,20H,7-9H2,1-6H3/t15-,17-/m0/s1 |
| InChIKey | UMHOIZHEOJTXQP-RDJZCZTQSA-N |
| XLogP | 4.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |