C12H12F3NO4 — CID 102735560
trans-(1R,2R)-2-[2-nitro-4-(trifluoromethyl)phenoxy]cyclopentan-1-ol (PubChem CID 102735560) has the molecular formula C12H12F3NO4 and a molecular weight of 291.22 g/mol. Its IUPAC name is trans-(1R,2R)-2-[2-nitro-4-(trifluoromethyl)phenoxy]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[2-nitro-4-(trifluoromethyl)phenoxy]cyclopentan-1-ol |
|---|---|
| PubChem CID | 102735560 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | trans-(1R,2R)-2-[2-nitro-4-(trifluoromethyl)phenoxy]cyclopentan-1-ol |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1O[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C12H12F3NO4/c13-12(14,15)7-4-5-10(8(6-7)16(18)19)20-11-3-1-2-9(11)17/h4-6,9,11,17H,1-3H2/t9-,11-/m1/s1 |
| InChIKey | NSTMSFUQDXEIOE-MWLCHTKSSA-N |
| XLogP | 2.91 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|