C13H17NO4 — CID 114088176
trans-(1S,2S)-2-(2,4-dimethyl-5-nitrophenoxy)cyclopentan-1-ol (PubChem CID 114088176) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2,4-dimethyl-5-nitrophenoxy)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2,4-dimethyl-5-nitrophenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 114088176 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | trans-(1S,2S)-2-(2,4-dimethyl-5-nitrophenoxy)cyclopentan-1-ol |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1O[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C13H17NO4/c1-8-6-9(2)13(7-10(8)14(16)17)18-12-5-3-4-11(12)15/h6-7,11-12,15H,3-5H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | XQOKQPWMUKODFM-RYUDHWBXSA-N |
| XLogP | 2.50 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|