C12H12N2O4 — CID 102735480
4-[(1R,2R)-2-hydroxycyclopentyl]oxy-3-nitrobenzonitrile (PubChem CID 102735480) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 4-[(1R,2R)-2-hydroxycyclopentyl]oxy-3-nitrobenzonitrile.
| Compound Name | 4-[(1R,2R)-2-hydroxycyclopentyl]oxy-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 102735480 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-[(1R,2R)-2-hydroxycyclopentyl]oxy-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(O[C@@H]2CCC[C@H]2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H12N2O4/c13-7-8-4-5-11(9(6-8)14(16)17)18-12-3-1-2-10(12)15/h4-6,10,12,15H,1-3H2/t10-,12-/m1/s1 |
| InChIKey | HOZJKOMXEVORLT-ZYHUDNBSSA-N |
| XLogP | 1.76 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|