C11H12F2O2 — CID 60878215
2-(2,4-difluorophenoxy)cyclopentan-1-ol (PubChem CID 60878215) has the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)cyclopentan-1-ol.
| Compound Name | 2-(2,4-difluorophenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 60878215 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(2,4-difluorophenoxy)cyclopentan-1-ol |
| SMILES | OC1CCCC1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2O2/c12-7-4-5-10(8(13)6-7)15-11-3-1-2-9(11)14/h4-6,9,11,14H,1-3H2 |
| InChIKey | NTUSWEPTUFCBRP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |