C17H24F2O2 — CID 63471376
2-(2,4-difluorophenoxy)-4-(2-methylbutan-2-yl)cyclohexan-1-ol (PubChem CID 63471376) has the molecular formula C17H24F2O2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-4-(2-methylbutan-2-yl)cyclohexan-1-ol.
| Compound Name | 2-(2,4-difluorophenoxy)-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 63471376 |
| Molecular Formula | C17H24F2O2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-4-(2-methylbutan-2-yl)cyclohexan-1-ol |
| SMILES | CCC(C)(C)C1CCC(O)C(Oc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H24F2O2/c1-4-17(2,3)11-5-7-14(20)16(9-11)21-15-8-6-12(18)10-13(15)19/h6,8,10-11,14,16,20H,4-5,7,9H2,1-3H3 |
| InChIKey | KEGVIHHDWNHQNT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |