C12H14F2O2 — CID 102732616
trans-(1R,2R)-2-(2,5-difluorophenoxy)cyclohexan-1-ol (PubChem CID 102732616) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is trans-(1R,2R)-2-(2,5-difluorophenoxy)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(2,5-difluorophenoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732616 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | trans-(1R,2R)-2-(2,5-difluorophenoxy)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1Oc1cc(F)ccc1F |
| InChI | InChI=1S/C12H14F2O2/c13-8-5-6-9(14)12(7-8)16-11-4-2-1-3-10(11)15/h5-7,10-11,15H,1-4H2/t10-,11-/m1/s1 |
| InChIKey | LWMZVMASSYZLGK-GHMZBOCLSA-N |
| XLogP | 2.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |