C10H10F2O2 — CID 66346063
3-(2,5-difluorophenoxy)cyclobutan-1-ol (PubChem CID 66346063) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 3-(2,5-difluorophenoxy)cyclobutan-1-ol.
| Compound Name | 3-(2,5-difluorophenoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 66346063 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(2,5-difluorophenoxy)cyclobutan-1-ol |
| SMILES | OC1CC(Oc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C10H10F2O2/c11-6-1-2-9(12)10(3-6)14-8-4-7(13)5-8/h1-3,7-8,13H,4-5H2 |
| InChIKey | YRWOLVOMCHZDAJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |