C10H10F2O — CID 130038404
2-cyclobutyloxy-1,4-difluorobenzene (PubChem CID 130038404) has the molecular formula C10H10F2O and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-cyclobutyloxy-1,4-difluorobenzene.
| Compound Name | 2-cyclobutyloxy-1,4-difluorobenzene |
|---|---|
| PubChem CID | 130038404 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-cyclobutyloxy-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(OC2CCC2)c1 |
| InChI | InChI=1S/C10H10F2O/c11-7-4-5-9(12)10(6-7)13-8-2-1-3-8/h4-6,8H,1-3H2 |
| InChIKey | OLFSKFSIPUZJGO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |