C18H29NO — CID 43294229
[2-(4-tert-butyl-2-methylphenoxy)cyclohexyl]methanamine (PubChem CID 43294229) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is [2-(4-tert-butyl-2-methylphenoxy)cyclohexyl]methanamine.
| Compound Name | [2-(4-tert-butyl-2-methylphenoxy)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 43294229 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | [2-(4-tert-butyl-2-methylphenoxy)cyclohexyl]methanamine |
| SMILES | Cc1cc(C(C)(C)C)ccc1OC1CCCCC1CN |
| InChI | InChI=1S/C18H29NO/c1-13-11-15(18(2,3)4)9-10-16(13)20-17-8-6-5-7-14(17)12-19/h9-11,14,17H,5-8,12,19H2,1-4H3 |
| InChIKey | SORWYDBTEWKVTJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |