4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride

C15H21ClO3S — CID 63863945

IUPAC4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride
SMILESCCC1CCCCC1Oc1ccc(S(=O)(=O)Cl)cc1C
InChIInChI=1S/C15H21ClO3S/c1-3-12-6-4-5-7-15(12)19-14-9-8-13(10-11(14)2)20(16,17)18/h8-10,12,15H,3-7H2,1-2H3
InChIKeyYMHFFAUYTYINOP-UHFFFAOYSA-N
MW316.85 g/mol
LogP4.27
Rot. Bonds4

About 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride

4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride (PubChem CID 63863945) has the molecular formula C15H21ClO3S and a molecular weight of 316.85 g/mol. Its IUPAC name is 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride.

Molecular Properties

Compound Name4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride
PubChem CID63863945
Molecular FormulaC15H21ClO3S
Molecular Weight316.85 g/mol
Exact Mass316.09
IUPAC Name4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride
SMILESCCC1CCCCC1Oc1ccc(S(=O)(=O)Cl)cc1C
InChIInChI=1S/C15H21ClO3S/c1-3-12-6-4-5-7-15(12)19-14-9-8-13(10-11(14)2)20(16,17)18/h8-10,12,15H,3-7H2,1-2H3
InChIKeyYMHFFAUYTYINOP-UHFFFAOYSA-N
XLogP4.27
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.85
LogP ≤ 54.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride?
The IUPAC name of 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride (CID 63863945) is 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride.
What is the SMILES notation for 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride?
The canonical SMILES for 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride is CCC1CCCCC1Oc1ccc(S(=O)(=O)Cl)cc1C.
What is the InChIKey of 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride?
The InChIKey is YMHFFAUYTYINOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO3S/c1-3-12-6-4-5-7-15(12)19-14-9-8-13(10-11(14)2)20(16,17)18/h8-10,12,15H,3-7H2,1-2H3.
What are the key properties of 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride?
4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride has a molecular weight of 316.85 g/mol, XLogP of 4.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylcyclohexyl)oxy-3-methylbenzenesulfonyl chloride is sourced from PubChem (CID 63863945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).