C12H16ClN2OP — CID 11242704
(1R,3aS)-1-(chloromethyl)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide (PubChem CID 11242704) has the molecular formula C12H16ClN2OP and a molecular weight of 270.70 g/mol. Its IUPAC name is (1R,3aS)-1-(chloromethyl)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide.
| Compound Name | (1R,3aS)-1-(chloromethyl)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide |
|---|---|
| PubChem CID | 11242704 |
| Molecular Formula | C12H16ClN2OP |
| Molecular Weight | 270.70 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (1R,3aS)-1-(chloromethyl)-2-phenyl-3a,4,5,6-tetrahydro-3H-pyrrolo[1,2-c][1,3,2]diazaphosphole 1-oxide |
| SMILES | O=[P@@]1(CCl)N(c2ccccc2)C[C@@H]2CCCN21 |
| InChI | InChI=1S/C12H16ClN2OP/c13-10-17(16)14-8-4-7-12(14)9-15(17)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2/t12-,17+/m0/s1 |
| InChIKey | LQVYTYPRSGMMRI-YVEFUNNKSA-N |
| XLogP | 3.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.70 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|