C12H16N2 — CID 141032267
(7aS)-2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole (PubChem CID 141032267) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (7aS)-2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole.
| Compound Name | (7aS)-2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole |
|---|---|
| PubChem CID | 141032267 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (7aS)-2-phenyl-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazole |
| SMILES | c1ccc(N2C[C@@H]3CCCN3C2)cc1 |
| InChI | InChI=1S/C12H16N2/c1-2-5-11(6-3-1)14-9-12-7-4-8-13(12)10-14/h1-3,5-6,12H,4,7-10H2/t12-/m0/s1 |
| InChIKey | VMXVIUFYYDGVEJ-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |