C20H32N4O — CID 95337645
(2R)-1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(4-phenylpiperazin-1-yl)propan-2-ol (PubChem CID 95337645) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is (2R)-1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(4-phenylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 95337645 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (2R)-1-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-3-(4-phenylpiperazin-1-yl)propan-2-ol |
| SMILES | O[C@H](CN1CCN(c2ccccc2)CC1)CN1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C20H32N4O/c25-20(17-22-11-14-23-8-4-7-19(23)15-22)16-21-9-12-24(13-10-21)18-5-2-1-3-6-18/h1-3,5-6,19-20,25H,4,7-17H2/t19-,20-/m1/s1 |
| InChIKey | PBACCJZHGPFLSN-WOJBJXKFSA-N |
| XLogP | 0.95 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |