C18H27N5O2 — CID 95725452
[2-oxo-2-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]urea (PubChem CID 95725452) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is [2-oxo-2-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]urea.
| Compound Name | [2-oxo-2-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]urea |
|---|---|
| PubChem CID | 95725452 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | [2-oxo-2-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]urea |
| SMILES | NC(=O)NCC(=O)N1CCC[C@H](N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C18H27N5O2/c19-18(25)20-13-17(24)23-8-4-7-16(14-23)22-11-9-21(10-12-22)15-5-2-1-3-6-15/h1-3,5-6,16H,4,7-14H2,(H3,19,20,25)/t16-/m0/s1 |
| InChIKey | HJBGNMZMMPEXKK-INIZCTEOSA-N |
| XLogP | 0.47 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |