C20H26N4O3S — CID 42099253
3-[2-oxo-2-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 42099253) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-[2-oxo-2-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-oxo-2-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 42099253 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 3-[2-oxo-2-[(3R)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)CSC1=O)N1CCC[C@@H](N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C20H26N4O3S/c25-18(14-24-19(26)15-28-20(24)27)23-8-4-7-17(13-23)22-11-9-21(10-12-22)16-5-2-1-3-6-16/h1-3,5-6,17H,4,7-15H2/t17-/m1/s1 |
| InChIKey | OYJXUBFTBXOZOS-QGZVFWFLSA-N |
| XLogP | 1.50 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|