C18H23N3O2S — CID 95590167
4-[2-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-oxoethyl]-1,4-benzothiazin-3-one (PubChem CID 95590167) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 4-[2-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-oxoethyl]-1,4-benzothiazin-3-one.
| Compound Name | 4-[2-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 95590167 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-[2-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)N1CCN2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C18H23N3O2S/c22-17(20-10-9-19-8-4-3-5-14(19)11-20)12-21-15-6-1-2-7-16(15)24-13-18(21)23/h1-2,6-7,14H,3-5,8-13H2/t14-/m1/s1 |
| InChIKey | NVGROLSTXGLJNL-CQSZACIVSA-N |
| XLogP | 1.82 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |