C22H25N3O2S — CID 18157500
4-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]-1,4-benzothiazin-3-one (PubChem CID 18157500) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]-1,4-benzothiazin-3-one.
| Compound Name | 4-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 18157500 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]-1,4-benzothiazin-3-one |
| SMILES | O=C(CN1C(=O)CSc2ccccc21)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25N3O2S/c26-21(16-25-19-9-4-5-10-20(19)28-17-22(25)27)24-12-6-11-23(13-14-24)15-18-7-2-1-3-8-18/h1-5,7-10H,6,11-17H2 |
| InChIKey | MTQQAEMPQBVNLB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |