C22H24N4O3 — CID 30470000
1-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]quinazoline-2,4-dione (PubChem CID 30470000) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]quinazoline-2,4-dione.
| Compound Name | 1-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 30470000 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[2-(4-benzyl-1,4-diazepan-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
| SMILES | O=C(Cn1c(=O)[nH]c(=O)c2ccccc21)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N4O3/c27-20(16-26-19-10-5-4-9-18(19)21(28)23-22(26)29)25-12-6-11-24(13-14-25)15-17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H,23,28,29) |
| InChIKey | JNOOAPLEKYDAOV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |