C17H21N3O3 — CID 17437474
1-[2-(azocan-1-yl)-2-oxoethyl]quinazoline-2,4-dione (PubChem CID 17437474) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-[2-(azocan-1-yl)-2-oxoethyl]quinazoline-2,4-dione.
| Compound Name | 1-[2-(azocan-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 17437474 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[2-(azocan-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
| SMILES | O=C(Cn1c(=O)[nH]c(=O)c2ccccc21)N1CCCCCCC1 |
| InChI | InChI=1S/C17H21N3O3/c21-15(19-10-6-2-1-3-7-11-19)12-20-14-9-5-4-8-13(14)16(22)18-17(20)23/h4-5,8-9H,1-3,6-7,10-12H2,(H,18,22,23) |
| InChIKey | IWIIMCAOMIIINC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |