C15H17N3O3 — CID 36865914
1-(2-oxo-2-piperidin-1-ylethyl)quinazoline-2,4-dione (PubChem CID 36865914) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-(2-oxo-2-piperidin-1-ylethyl)quinazoline-2,4-dione.
| Compound Name | 1-(2-oxo-2-piperidin-1-ylethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 36865914 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(2-oxo-2-piperidin-1-ylethyl)quinazoline-2,4-dione |
| SMILES | O=C(Cn1c(=O)[nH]c(=O)c2ccccc21)N1CCCCC1 |
| InChI | InChI=1S/C15H17N3O3/c19-13(17-8-4-1-5-9-17)10-18-12-7-3-2-6-11(12)14(20)16-15(18)21/h2-3,6-7H,1,4-5,8-10H2,(H,16,20,21) |
| InChIKey | KZVFCBOHOBKTSZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |