C23H25N3O3 — CID 154850217
1-[2-(4,4-dimethyl-3-phenylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione (PubChem CID 154850217) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1-[2-(4,4-dimethyl-3-phenylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione.
| Compound Name | 1-[2-(4,4-dimethyl-3-phenylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 154850217 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[2-(4,4-dimethyl-3-phenylpiperidin-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
| SMILES | CC1(C)CCN(C(=O)Cn2c(=O)[nH]c(=O)c3ccccc32)CC1c1ccccc1 |
| InChI | InChI=1S/C23H25N3O3/c1-23(2)12-13-25(14-18(23)16-8-4-3-5-9-16)20(27)15-26-19-11-7-6-10-17(19)21(28)24-22(26)29/h3-11,18H,12-15H2,1-2H3,(H,24,28,29) |
| InChIKey | SNOCLIVXLLGDLI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |