C19H17N3O3 — CID 167987362
1-[2-(4-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]quinazoline-2,4-dione (PubChem CID 167987362) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[2-(4-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]quinazoline-2,4-dione.
| Compound Name | 1-[2-(4-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 167987362 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-[2-(4-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl]quinazoline-2,4-dione |
| SMILES | Cc1cccc2c1CCN2C(=O)Cn1c(=O)[nH]c(=O)c2ccccc21 |
| InChI | InChI=1S/C19H17N3O3/c1-12-5-4-8-15-13(12)9-10-21(15)17(23)11-22-16-7-3-2-6-14(16)18(24)20-19(22)25/h2-8H,9-11H2,1H3,(H,20,24,25) |
| InChIKey | BHRXVJOMDZECIR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |