C22H22N4O4 — CID 24545134
1-[3-(4-benzoylpiperazin-1-yl)-3-oxopropyl]quinazoline-2,4-dione (PubChem CID 24545134) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 1-[3-(4-benzoylpiperazin-1-yl)-3-oxopropyl]quinazoline-2,4-dione.
| Compound Name | 1-[3-(4-benzoylpiperazin-1-yl)-3-oxopropyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 24545134 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 1-[3-(4-benzoylpiperazin-1-yl)-3-oxopropyl]quinazoline-2,4-dione |
| SMILES | O=C(CCn1c(=O)[nH]c(=O)c2ccccc21)N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N4O4/c27-19(10-11-26-18-9-5-4-8-17(18)20(28)23-22(26)30)24-12-14-25(15-13-24)21(29)16-6-2-1-3-7-16/h1-9H,10-15H2,(H,23,28,30) |
| InChIKey | SZKKNXLPHPFOIU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |