C19H25N5O3 — CID 146092841
1-[2-oxo-2-(3-piperazin-1-ylpiperidin-1-yl)ethyl]quinazoline-2,4-dione (PubChem CID 146092841) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-[2-oxo-2-(3-piperazin-1-ylpiperidin-1-yl)ethyl]quinazoline-2,4-dione.
| Compound Name | 1-[2-oxo-2-(3-piperazin-1-ylpiperidin-1-yl)ethyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 146092841 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-[2-oxo-2-(3-piperazin-1-ylpiperidin-1-yl)ethyl]quinazoline-2,4-dione |
| SMILES | O=C(Cn1c(=O)[nH]c(=O)c2ccccc21)N1CCCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C19H25N5O3/c25-17(23-9-3-4-14(12-23)22-10-7-20-8-11-22)13-24-16-6-2-1-5-15(16)18(26)21-19(24)27/h1-2,5-6,14,20H,3-4,7-13H2,(H,21,26,27) |
| InChIKey | PZDWHIREMFQLBJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 90.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |