C24H31N3OS — CID 25274910
2-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethanone (PubChem CID 25274910) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 25274910 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenylpiperazin-1-yl)piperidin-1-yl]ethanone |
| SMILES | CSc1ccc(CC(=O)N2CCC[C@H](N3CCN(c4ccccc4)CC3)C2)cc1 |
| InChI | InChI=1S/C24H31N3OS/c1-29-23-11-9-20(10-12-23)18-24(28)27-13-5-8-22(19-27)26-16-14-25(15-17-26)21-6-3-2-4-7-21/h2-4,6-7,9-12,22H,5,8,13-19H2,1H3/t22-/m0/s1 |
| InChIKey | PCDBQGLUVKCZRG-QFIPXVFZSA-N |
| XLogP | 3.76 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |