C16H18FN3O3S — CID 24791370
3-[2-[3-(4-fluoroanilino)piperidin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 24791370) has the molecular formula C16H18FN3O3S and a molecular weight of 351.40 g/mol. Its IUPAC name is 3-[2-[3-(4-fluoroanilino)piperidin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[2-[3-(4-fluoroanilino)piperidin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 24791370 |
| Molecular Formula | C16H18FN3O3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[2-[3-(4-fluoroanilino)piperidin-1-yl]-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)CSC1=O)N1CCCC(Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H18FN3O3S/c17-11-3-5-12(6-4-11)18-13-2-1-7-19(8-13)14(21)9-20-15(22)10-24-16(20)23/h3-6,13,18H,1-2,7-10H2 |
| InChIKey | BQRAYVSOWSJTJS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|