C19H25FN2O — CID 25452205
2-(cyclohexen-1-yl)-1-[(3S)-3-(4-fluoroanilino)piperidin-1-yl]ethanone (PubChem CID 25452205) has the molecular formula C19H25FN2O and a molecular weight of 316.42 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-1-[(3S)-3-(4-fluoroanilino)piperidin-1-yl]ethanone.
| Compound Name | 2-(cyclohexen-1-yl)-1-[(3S)-3-(4-fluoroanilino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 25452205 |
| Molecular Formula | C19H25FN2O |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-(cyclohexen-1-yl)-1-[(3S)-3-(4-fluoroanilino)piperidin-1-yl]ethanone |
| SMILES | O=C(CC1=CCCCC1)N1CCC[C@H](Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H25FN2O/c20-16-8-10-17(11-9-16)21-18-7-4-12-22(14-18)19(23)13-15-5-2-1-3-6-15/h5,8-11,18,21H,1-4,6-7,12-14H2/t18-/m0/s1 |
| InChIKey | QZRYXUPEVJYDOP-SFHVURJKSA-N |
| XLogP | 4.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|